|
CAS#: 3293-89-8 Product: Dimethyl 2,5-Dichlorobenzene-1,4-Dicarboxylate No suppilers available for the product. |
| Name | Dimethyl 2,5-Dichlorobenzene-1,4-Dicarboxylate |
|---|---|
| Synonyms | 2,5-Dichlorobenzene-1,4-Dicarboxylic Acid Dimethyl Ester; Iflab1_000211; Idi1_008430 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8Cl2O4 |
| Molecular Weight | 263.08 |
| CAS Registry Number | 3293-89-8 |
| EINECS | 221-958-8 |
| SMILES | C1=C(Cl)C(=CC(=C1C(OC)=O)Cl)C(OC)=O |
| InChI | 1S/C10H8Cl2O4/c1-15-9(13)5-3-8(12)6(4-7(5)11)10(14)16-2/h3-4H,1-2H3 |
| InChIKey | RDDWGNUSHLFXED-UHFFFAOYSA-N |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Dimethyl 2,5-Dichlorobenzene-1,4-Dicarboxylate |