|
CAS#: 473401-83-1 Product: Dimethyl 3,4-Dibromo-1H-Pyrrole-2,5-Dicarboxylate No suppilers available for the product. |
| Name | Dimethyl 3,4-Dibromo-1H-Pyrrole-2,5-Dicarboxylate |
|---|---|
| Synonyms | 3,4-Dibromo-1H-pyrrole-2,5-dicarboxylic acid dimethyl ester; Dimethyl 3,4-dibromo-1H-pyrrole-2,5-dicarboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7Br2NO4 |
| Molecular Weight | 340.95 |
| CAS Registry Number | 473401-83-1 |
| SMILES | Brc1c(C(=O)OC)nc(C(=O)OC)c1Br |
| InChI | 1S/C8H7Br2NO4/c1-14-7(12)5-3(9)4(10)6(11-5)8(13)15-2/h11H,1-2H3 |
| InChIKey | NFAUQKWYXQETPA-UHFFFAOYSA-N |
| Density | 1.938g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.431°C at 760 mmHg (Cal.) |
| Flash point | 195.369°C (Cal.) |
| Refractive index | 1.593 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl 3,4-Dibromo-1H-Pyrrole-2,5-Dicarboxylate |