| Nantong Zhonghe Chemical New Material Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.ntzhhg.com | |||
![]() | +86 13003551299 | |||
![]() | 2369399482@qq.com | |||
![]() | QQ Chat | |||
| Chemical distributor since 2019 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | 4,46,6-Di-tert-butyl-2,2-thiobisphenol |
|---|---|
| Synonyms | 2,4-ditert-butyl-6-(3,5-ditert-butyl-2-hydroxyphenyl)sulfanylphenol |
| Molecular Structure | ![]() |
| Molecular Formula | C28H42O2S |
| Molecular Weight | 442.70 |
| CAS Registry Number | 3293-91-2 |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)SC2=CC(=CC(=C2O)C(C)(C)C)C(C)(C)C)O)C(C)(C)C |
| Solubility | 2.707e-006 mg/L (25 °C water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.567, Calc.* |
| Melting point | 218.60 °C |
| Boiling Point | 512.84 °C, 486.6±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 236.0±27.4 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 4,46,6-Di-tert-butyl-2,2-thiobisphenol |