Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-(Trifluoromethoxy)Benzoyl Fluoride |
|---|---|
| Synonyms | Benzoyl Fluoride, 4-(Trifluoromethoxy)- |
| Molecular Structure |  |
| Molecular Formula | C8H4F4O2 |
| Molecular Weight | 208.11 |
| CAS Registry Number | 330-11-0 |
| EINECS | 206-351-8 |
| SMILES | C1=C(OC(F)(F)F)C=CC(=C1)C(=O)F |
| InChI | 1S/C8H4F4O2/c9-7(13)5-1-3-6(4-2-5)14-8(10,11)12/h1-4H |
| InChIKey | UKJWAZZCGZQPTA-UHFFFAOYSA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 179.683°C at 760 mmHg (Cal.) |
| Flash point | 61.209°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Trifluoromethoxy)Benzoyl Fluoride |