Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 5-(Trifluoromethoxy)-1,3-benzothiazole |
|---|---|
| Synonyms | 5-(Trifluormethoxy)-1,3-benzothiazol; 5-(Trifluoromethoxy)-1,3-benzothiazole; 5-(Trifluorométhoxy)-1,3-benzothiazole |
| Molecular Structure |  |
| Molecular Formula | C8H4F3NOS |
| Molecular Weight | 219.18 |
| CAS Registry Number | 876500-74-2 |
| SMILES | C1=CC2=C(C=C1OC(F)(F)F)N=CS2 |
| InChI | 1S/C8H4F3NOS/c9-8(10,11)13-5-1-2-7-6(3-5)12-4-14-7/h1-4H |
| InChIKey | KUZWMMJBAFVTFG-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 228.8±35.0°C at 760 mmHg (Cal.) |
| Flash point | 92.2±25.9°C (Cal.) |
| Refractive index | 1.564 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(Trifluoromethoxy)-1,3-benzothiazole |