Online Database of Chemicals from Around the World
|
CAS#: 3304-78-7 Product: N,N'-Dimethyl-1-Propylimidazole-4,5-Dicarboxamide No suppilers available for the product. |
| Name | N,N'-Dimethyl-1-Propylimidazole-4,5-Dicarboxamide |
|---|---|
| Synonyms | N,N'-Dimethyl-1-Propyl-Imidazole-4,5-Dicarboxamide; 1H-Imidazole-4,5-Dicarboxamide, N,N'-Dimethyl-1-Propyl-; Propylnorantifein |
| Molecular Structure |  |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 |
| CAS Registry Number | 3304-78-7 |
| SMILES | C1=NC(=C([N]1CCC)C(=O)NC)C(=O)NC |
| InChI | 1S/C10H16N4O2/c1-4-5-14-6-13-7(9(15)11-2)8(14)10(16)12-3/h6H,4-5H2,1-3H3,(H,11,15)(H,12,16) |
| InChIKey | MLEDDOPNEFCSTH-UHFFFAOYSA-N |
| Density | 1.232g/cm3 (Cal.) |
|---|---|
| Boiling point | 558.614°C at 760 mmHg (Cal.) |
| Flash point | 291.639°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N'-Dimethyl-1-Propylimidazole-4,5-Dicarboxamide |