Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Hamari Chemicals, Ltd. | Japan | Inquire | ||
|---|---|---|---|---|
|
+81 (6) 6322-0191 | |||
|
sales2@hamari.co.jp | |||
| Chemical manufacturer since 1948 | ||||
| Name | L-Balenine |
|---|---|
| Synonyms | (2S)-2-Amino-3-(1-Methyl-4-Imidazolyl)Propanoic Acid (3-Amino-1-Oxopropyl) Ester; (2S)-2-Amino-3-(1-Methylimidazol-4-Yl)Propionic Acid 3-Aminopropanoyl Ester; Balenine |
| Molecular Structure |  |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 |
| CAS Registry Number | 331-38-4 |
| SMILES | [C@@H](N)(C(OC(=O)CCN)=O)CC1=C[N](C=N1)C |
| InChI | 1S/C10H16N4O3/c1-14-5-7(13-6-14)4-8(12)10(16)17-9(15)2-3-11/h5-6,8H,2-4,11-12H2,1H3/t8-/m0/s1 |
| InChIKey | QAWKDPXGVJMDHM-QMMMGPOBSA-N |
| Density | 1.378g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.885°C at 760 mmHg (Cal.) |
| Flash point | 230.116°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-Balenine |