Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,7-Dimethylpurin-6-One |
|---|---|
| Synonyms | 1,7-Dimethyl-6-Purinone; 1,7-Dimethylhypoxanthine; 6H-Purin-6-One, 1,7-Dihydro-1,7-Dimethyl- |
| Molecular Structure |  |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 |
| CAS Registry Number | 33155-83-8 |
| EINECS | 251-395-3 |
| SMILES | C2=NC1=C(C(N(C)C=N1)=O)[N]2C |
| InChI | 1S/C7H8N4O/c1-10-3-8-6-5(10)7(12)11(2)4-9-6/h3-4H,1-2H3 |
| InChIKey | ZIVNUESELYYTHV-UHFFFAOYSA-N |
| Density | 1.431g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.079°C at 760 mmHg (Cal.) |
| Flash point | 204.833°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,7-Dimethylpurin-6-One |