Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N6,N6-Dimethyl-1H-Purine-6,8-Diamine |
|---|---|
| Synonyms | N6,N6-dimethyl-1H-purine-6,8-diamine |
| Molecular Structure |  |
| Molecular Formula | C7H10N6 |
| Molecular Weight | 178.19 |
| CAS Registry Number | 374706-45-3 |
| SMILES | CN(C)c1c2c(ncn1)nc([nH]2)N |
| InChI | 1S/C7H10N6/c1-13(2)6-4-5(9-3-10-6)12-7(8)11-4/h3H,1-2H3,(H3,8,9,10,11,12) |
| InChIKey | YJUNMCCYAXBBPV-UHFFFAOYSA-N |
| Density | 1.463g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.769°C at 760 mmHg (Cal.) |
| Flash point | 217.95°C (Cal.) |
| Refractive index | 1.785 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N6,N6-Dimethyl-1H-Purine-6,8-Diamine |