Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (6R)-6-[(E)-But-1-Enyl]Cyclohepta-1,4-Diene |
|---|---|
| Synonyms | 1,4-Cycloheptadiene, 6-(1-Butenyl)-, (R-(Z))-; 1-(1-Butenyl)-2,5-Cycloheptadiene; Ectocarpene |
| Molecular Structure | ![CAS#: 33156-93-3， (6R)-6-[(E)-But-1-Enyl]Cyclohepta-1,4-Diene](/moreStructures/33156-93-3.gif) |
| Molecular Formula | C11H16 |
| CAS Registry Number | 33156-93-3 |
| SMILES | [C@@H]1(CC=CCC=C1)\C=C\CC |
| InChI | 1S/C11H16/c1-2-3-8-11-9-6-4-5-7-10-11/h3-4,6-8,10-11H,2,5,9H2,1H3/b8-3+/t11-/m0/s1 |
| InChIKey | KIFXGGYCNMHCSX-AEBAWRHJSA-N |
| Density | 0.908g/cm3 (Cal.) |
|---|---|
| Boiling point | 207.389°C at 760 mmHg (Cal.) |
| Flash point | 63.492°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (6R)-6-[(E)-But-1-Enyl]Cyclohepta-1,4-Diene |