| Zhengzhou Kingorgchem Chemical Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.kingorgchem.com | |||
![]() | +86 (371) 6551-1006 | |||
![]() | +86 (371) 6575-6965 | |||
![]() | sales@kingorgchem.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 18625597674 | |||
| Chemical manufacturer since 2015 | ||||
| chemBlink Standard supplier since 2016 | ||||
| Classification | Organic raw materials >> Organometallic compound >> Organic palladium |
|---|---|
| Name | [(1,2,3-eta)-2-Butenyl]chloro(tricyclohexylphosphine)palladium |
| Molecular Structure | ![]() |
| Molecular Formula | C22H40ClPPd |
| Molecular Weight | 477.40 |
| CAS Registry Number | 307494-95-7 |
| SMILES | C/C=C[CH2-].C1CCC(CC1)P(C2CCCCC2)C3CCCCC3.Cl[Pd+] |
| Hazard Symbols | |
|---|---|
| Risk Statements | H315-H319-H335 Details |
| Safety Statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362-P403+P233-P501 Details |
| SDS | Available |
|
[(1,2,3-eta)-2-Butenyl]chloro(tricyclohexylphosphine)palladium is an organometallic compound that plays a crucial role in various catalytic processes. This complex consists of a palladium center coordinated by a butenyl ligand, a chlorine atom, and a tricyclohexylphosphine ligand. Its unique structure makes it a valuable tool in synthetic chemistry, particularly in transition metal-catalyzed reactions. The discovery of [(1,2,3-eta)-2-Butenyl]chloro(tricyclohexylphosphine)palladium was driven by the need for effective palladium catalysts in organic synthesis. The choice of ligands—tricyclohexylphosphine and a butenyl group—enhances the stability and reactivity of the palladium center, making the complex suitable for a variety of catalytic applications. One of the primary applications of this palladium complex is in cross-coupling reactions, such as the Suzuki and Heck reactions. These reactions are pivotal in forming carbon-carbon bonds, which are fundamental in the synthesis of complex organic molecules, including pharmaceuticals and fine chemicals. The tricyclohexylphosphine ligand stabilizes the palladium center and facilitates the coupling of organic substrates, while the butenyl group provides additional reactivity. In addition to cross-coupling reactions, [(1,2,3-eta)-2-Butenyl]chloro(tricyclohexylphosphine)palladium is used in other metal-catalyzed transformations, such as hydrosilylation and hydroamination reactions. Its ability to form stable and reactive complexes with various substrates makes it a versatile tool in organic synthesis, enabling the development of new chemical entities and materials. The use of [(1,2,3-eta)-2-Butenyl]chloro(tricyclohexylphosphine)palladium has expanded the scope of palladium-catalyzed reactions, providing chemists with a powerful reagent for constructing complex organic molecules. Its development represents a significant advancement in the field of organometallic chemistry, highlighting the importance of tailored ligands and metal centers in achieving efficient and selective catalysis. Overall, [(1,2,3-eta)-2-Butenyl]chloro(tricyclohexylphosphine)palladium is a valuable compound in synthetic chemistry, known for its role in facilitating various palladium-catalyzed reactions. Its contributions to chemical synthesis underscore its significance in advancing both academic research and industrial applications. |
| Market Analysis Reports |