Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Clidafidine |
|---|---|
| Synonyms | N-(2,6-Dichlorophenyl)-4,5-Dihydrooxazol-2-Amine; (2,6-Dichlorophenyl)-(4,5-Dihydrooxazol-2-Yl)Amine; 2-((2,6-Dichlorophenyl)-Imino)Oxazolidine. |
| Molecular Structure |  |
| Molecular Formula | C9H8Cl2N2O |
| Molecular Weight | 231.08 |
| CAS Registry Number | 33588-20-4 |
| SMILES | C1=C(C(=C(C=C1)Cl)NC2=NCCO2)Cl |
| InChI | 1S/C9H8Cl2N2O/c10-6-2-1-3-7(11)8(6)13-9-12-4-5-14-9/h1-3H,4-5H2,(H,12,13) |
| InChIKey | LZQLXSNYZUENIF-UHFFFAOYSA-N |
| Density | 1.491g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.516°C at 760 mmHg (Cal.) |
| Flash point | 135.547°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Clidafidine |