Online Database of Chemicals from Around the World
| Name | 1,2-Dinitrofluoranthene |
|---|---|
| Synonyms | Fluoranthene, 1,2-Dinitro; Brn 2542255; Ccris 4009 |
| Molecular Structure |  |
| Molecular Formula | C16H8N2O4 |
| Molecular Weight | 292.25 |
| CAS Registry Number | 33611-88-0 |
| SMILES | C4=C3C2=C(C1=CC=CC=C1C2=CC=C3)C(=C4[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C16H8N2O4/c19-17(20)13-8-9-4-3-7-11-10-5-1-2-6-12(10)15(14(9)11)16(13)18(21)22/h1-8H |
| InChIKey | ZVFDFXXVLYCTIA-UHFFFAOYSA-N |
| Density | 1.574g/cm3 (Cal.) |
|---|---|
| Boiling point | 548.282°C at 760 mmHg (Cal.) |
| Flash point | 282.389°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dinitrofluoranthene |
