Online Database of Chemicals from Around the World
|
CAS#: 55691-69-5 Product: 3,4-Dinitrofluoranthene No suppilers available for the product. |
| Name | 3,4-Dinitrofluoranthene |
|---|---|
| Synonyms | 4-05-00-02466 (Beilstein Handbook Reference); Brn 2337580; Ccris 2055 |
| Molecular Structure |  |
| Molecular Formula | C16H8N2O4 |
| Molecular Weight | 292.25 |
| CAS Registry Number | 55691-69-5 |
| SMILES | C1=CC3=C2C(=C1[N+]([O-])=O)C(=CC=C2C4=CC=CC=C34)[N+]([O-])=O |
| InChI | 1S/C16H8N2O4/c19-17(20)13-7-5-11-9-3-1-2-4-10(9)12-6-8-14(18(21)22)16(13)15(11)12/h1-8H |
| InChIKey | VNUUPDIHBNDQJJ-UHFFFAOYSA-N |
| Density | 1.574g/cm3 (Cal.) |
|---|---|
| Boiling point | 515.198°C at 760 mmHg (Cal.) |
| Flash point | 261.586°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dinitrofluoranthene |