Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 2-Ethyl-4-Quinolinecarboxylate |
|---|---|
| Synonyms | methyl 2-ethylquinoline-4-carboxylate |
| Molecular Structure |  |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 |
| CAS Registry Number | 337956-30-6 |
| SMILES | CCc1cc(c2ccccc2n1)C(=O)OC |
| InChI | 1S/C13H13NO2/c1-3-9-8-11(13(15)16-2)10-6-4-5-7-12(10)14-9/h4-8H,3H2,1-2H3 |
| InChIKey | WUWISTSTGSSYQA-UHFFFAOYSA-N |
| Density | 1.148g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.192°C at 760 mmHg (Cal.) |
| Flash point | 151.681°C (Cal.) |
| Refractive index | 1.593 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-Ethyl-4-Quinolinecarboxylate |