Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | [(1-Methylethyl)Sulfinyl]-Benzene |
|---|---|
| Synonyms | Isopropylsulfinylbenzene; Nsc316452 |
| Molecular Structure | ![CAS#: 4170-69-8， [(1-Methylethyl)Sulfinyl]-Benzene](/moreStructures/4170-69-8.gif) |
| Molecular Formula | C9H12OS |
| Molecular Weight | 168.25 |
| CAS Registry Number | 4170-69-8 |
| SMILES | C1=C([S](C(C)C)=O)C=CC=C1 |
| InChI | 1S/C9H12OS/c1-8(2)11(10)9-6-4-3-5-7-9/h3-8H,1-2H3 |
| InChIKey | MNPISBRDBQCTAF-UHFFFAOYSA-N |
| Density | 1.118g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.865°C at 760 mmHg (Cal.) |
| Flash point | 129.106°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(1-Methylethyl)Sulfinyl]-Benzene |