Online Database of Chemicals from Around the World
|
CAS#: 3380-68-5 Product: 5-Methoxypyrano[5,6-f][1]Benzoxol-7-One No suppilers available for the product. |
| Name | 5-Methoxypyrano[5,6-f][1]Benzoxol-7-One |
|---|---|
| Synonyms | 5-Methoxypyrano[5,6-F]Benzofuran-7-One; 5-Methoxy-7-Pyrano[5,6-F]Benzofuranone; 4-Methoxypsoralen |
| Molecular Structure | ![CAS#: 3380-68-5， 5-Methoxypyrano[5,6-f][1]Benzoxol-7-One](/moreStructures/3380-68-5.gif) |
| Molecular Formula | C12H8O4 |
| Molecular Weight | 216.19 |
| CAS Registry Number | 3380-68-5 |
| EINECS | 222-183-8 |
| SMILES | C1=C3C(=CC2=C1C(=CC(O2)=O)OC)OC=C3 |
| InChI | 1S/C12H8O4/c1-14-10-6-12(13)16-11-5-9-7(2-3-15-9)4-8(10)11/h2-6H,1H3 |
| InChIKey | IFBJMRYEEKIECT-UHFFFAOYSA-N |
| Density | 1.39g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.568°C at 760 mmHg (Cal.) |
| Flash point | 203.314°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methoxypyrano[5,6-f][1]Benzoxol-7-One |