Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6-Methoxy-3H-purine 1-oxide |
|---|---|
| Synonyms | 6-methoxy-9H-purine 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.14 |
| CAS Registry Number | 906723-81-7 |
| SMILES | COc1c2c(nc[nH]2)nc[n+]1[O-] |
| InChI | 1S/C6H6N4O2/c1-12-6-4-5(8-2-7-4)9-3-10(6)11/h2-3H,1H3,(H,7,8,9) |
| InChIKey | REOWGEDFNCQIOQ-UHFFFAOYSA-N |
| Density | 1.663g/cm3 (Cal.) |
|---|---|
| Boiling point | 571.13°C at 760 mmHg (Cal.) |
| Flash point | 299.209°C (Cal.) |
| Refractive index | 1.739 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methoxy-3H-purine 1-oxide |