|
CAS#: 358-72-5 Product: 3-Methylbut-2-Enyl Phosphono Hydrogen Phosphate No suppilers available for the product. |
| Name | 3-Methylbut-2-Enyl Phosphono Hydrogen Phosphate |
|---|---|
| Synonyms | Delta2-Isopentenyl Diphosphate; Dma; 3,3-Dimethylallyl Pyrophosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C5H12O7P2 |
| Molecular Weight | 246.09 |
| CAS Registry Number | 358-72-5 |
| SMILES | C(O[P](O[P](O)(O)=O)(O)=O)C=C(C)C |
| InChI | 1S/C5H12O7P2/c1-5(2)3-4-11-14(9,10)12-13(6,7)8/h3H,4H2,1-2H3,(H,9,10)(H2,6,7,8) |
| InChIKey | CBIDRCWHNCKSTO-UHFFFAOYSA-N |
| Density | 1.557g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.966°C at 760 mmHg (Cal.) |
| Flash point | 205.974°C (Cal.) |
| (1) | Ali Al-Mourabit, Manuel A. Zancanella, Supriya Tilvi and Daniel Romo. Biosynthesis, asymmetric synthesis, and pharmacology, including cellular targets, of the pyrrole-2-aminoimidazole marine alkaloids, Nat. Prod. Rep., 2011, 28, 1229. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Methylbut-2-Enyl Phosphono Hydrogen Phosphate |