|
CAS#: 95833-52-6 Product: 2-[4-(3-Methyl-2-buten-1-yl)phenyl]propanoic acid No suppilers available for the product. |
| Name | 2-[4-(3-Methyl-2-buten-1-yl)phenyl]propanoic acid |
|---|---|
| Synonyms | 2-(4-(3-methyl-2-butenyl)phenyl)propionic acid; 2-(4-(3-methylbut-2-en-1-yl)phenyl)propanoic acid; TA 60 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.29 |
| CAS Registry Number | 95833-52-6 |
| SMILES | O=C(O)C(c1ccc(cc1)C\C=C(/C)C)C |
| InChI | 1S/C14H18O2/c1-10(2)4-5-12-6-8-13(9-7-12)11(3)14(15)16/h4,6-9,11H,5H2,1-3H3,(H,15,16) |
| InChIKey | YZPIMMMQMYKRAK-UHFFFAOYSA-N |
| Density | 1.04g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.988°C at 760 mmHg (Cal.) |
| Flash point | 239.973°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[4-(3-Methyl-2-buten-1-yl)phenyl]propanoic acid |