| Cenik Chemicals Limited | England | Inquire | ||
|---|---|---|---|---|
![]() | www.cenikchemicals.com | |||
![]() | +44 7999660910 | |||
![]() | hello@cenikchemicals.com | |||
| Chemical distributor since 2021 | ||||
| chemBlink Standard supplier since 2021 | ||||
| Name | 2,2'-[(4-Nitrosophenyl)imino]bis-ethanol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 |
| CAS Registry Number | 3590-52-1 |
| EC Number | 222-731-6 |
| SMILES | C1=CC(=CC=C1N=O)N(CCO)CCO |
| Solubility | 1.45e+004 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.559, Calc.* |
| Melting point | 125.13 °C |
| Boiling Point | 346.97 °C, 429.7±40.0 °C (760 mmHg), Calc.* |
| Flash Point | 213.7±27.3 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H301-H312-H332 Details | ||||||||||||||||
| Safety Statements | P261-P264-P270-P271-P280-P301+P316-P302+P352-P304+P340-P317-P321-P330-P362+P364-P405-P501 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
| SDS | Available | ||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 2,2'-[(4-Nitrosophenyl)imino]bis-ethanol |