Online Database of Chemicals from Around the World
|
CAS#: 777-79-7 Product: 1-Nitroso-2-Phenylethylurea No suppilers available for the product. |
| Name | 1-Nitroso-2-Phenylethylurea |
|---|---|
| Synonyms | 3-12-00-02430 (Beilstein Handbook Reference); 2-Phenylethylnitrosourea; N-Nitroso-2-Phenylethylurea |
| Molecular Structure |  |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.20 |
| CAS Registry Number | 777-79-7 |
| SMILES | C1=C(CCN(C(=O)N)N=O)C=CC=C1 |
| InChI | 1S/C9H11N3O2/c10-9(13)12(11-14)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,10,13) |
| InChIKey | DTJMFZHAJPQACD-UHFFFAOYSA-N |
| Density | 1.24g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.971°C at 760 mmHg (Cal.) |
| Flash point | 155.176°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitroso-2-Phenylethylurea |