Online Database of Chemicals from Around the World
|
CAS#: 36101-39-0 Product: Carolinianine No suppilers available for the product. |
| Name | Carolinianine |
|---|---|
| Synonyms | Carolinianine |
| Molecular Structure |  |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 |
| CAS Registry Number | 36101-39-0 |
| SMILES | [C@@H]24N1C(=O)CCC[C@H]1C[C@@H]3N2[C@H](C=C(C)C3)[C@@H](CC4)O |
| InChI | 1S/C16H24N2O2/c1-10-7-12-9-11-3-2-4-16(20)18(11)15-6-5-14(19)13(8-10)17(12)15/h8,11-15,19H,2-7,9H2,1H3/t11-,12+,13+,14+,15-/m0/s1 |
| InChIKey | YRHGJVCKHYJQQO-JARUQAPTSA-N |
| Density | 1.251g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.983°C at 760 mmHg (Cal.) |
| Flash point | 235.618°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Carolinianine |