|
CAS#: 432-70-2 Product: beta,epsilon-Carotene No suppilers available for the product. |
| Name | beta,epsilon-Carotene |
|---|---|
| Synonyms | Chebi:28425; Alpha-Carotene, All-Trans-; .Alpha.-Carotene, All-Trans- |
| Molecular Structure | ![]() |
| Molecular Formula | C40H56 |
| Molecular Weight | 536.88 |
| CAS Registry Number | 432-70-2 |
| SMILES | CC1(C(C(=CCC1)C)\C=C\C(=C\C=C\C(=C\C=C\C=C(\C=C\C=C(\C=C\C2=C(CCCC2(C)C)C)C)C)C)C)C |
| InChI | 1S/C40H56/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-14,17-23,25-28,37H,15-16,24,29-30H2,1-10H3/b12-11+,19-13+,20-14+,27-25+,28-26+,31-17+,32-18+,33-21+,34-22+ |
| InChIKey | ANVAOWXLWRTKGA-JLTXGRSLSA-N |
| Density | 0.938g/cm3 (Cal.) |
|---|---|
| Boiling point | 644.937°C at 760 mmHg (Cal.) |
| Flash point | 341.169°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for beta,epsilon-Carotene |