Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,3,5-Tribromo-2-Ethenylbenzene |
|---|---|
| Synonyms | 1,3,5-Tribromo-2-Vinyl-Benzene; 1,3,5-Tribromo-2-Vinylbenzene; 1,3,5-Tribromo-2-Ethenyl-Benzene |
| Molecular Structure |  |
| Molecular Formula | C8H5Br3 |
| Molecular Weight | 340.84 |
| CAS Registry Number | 36327-34-1 |
| EINECS | 252-978-5 |
| SMILES | C1=C(C=C(Br)C(=C1Br)C=C)Br |
| InChI | 1S/C8H5Br3/c1-2-6-7(10)3-5(9)4-8(6)11/h2-4H,1H2 |
| InChIKey | ICKFOGODAXJVSQ-UHFFFAOYSA-N |
| Density | 2.079g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.634°C at 760 mmHg (Cal.) |
| Flash point | 140.624°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Tribromo-2-Ethenylbenzene |