Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,2,2-Tribromoethyl Phosphoromorpholinochloridate |
|---|---|
| Synonyms | 2,2,2-Tribromoethyl Morpholinochlorophosphonate |
| Molecular Structure |  |
| Molecular Formula | C6H10Br3ClNO3P |
| Molecular Weight | 450.29 |
| CAS Registry Number | 57575-15-2 |
| EINECS | 260-819-6 |
| SMILES | C(O[P](N1CCOCC1)(=O)Cl)C(Br)(Br)Br |
| InChI | 1S/C6H10Br3ClNO3P/c7-6(8,9)5-14-15(10,12)11-1-3-13-4-2-11/h1-5H2 |
| InChIKey | LROSUTJPBMEPEY-UHFFFAOYSA-N |
| Density | 2.176g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.589°C at 760 mmHg (Cal.) |
| Flash point | 190.626°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,2-Tribromoethyl Phosphoromorpholinochloridate |