Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N,N-Bis(Trifluoromethyl) Aniline |
|---|---|
| Synonyms | Phenyl-Bis(Trifluoromethyl)Amine |
| Molecular Structure |  |
| Molecular Formula | C8H5F6N |
| Molecular Weight | 229.12 |
| CAS Registry Number | 3700-19-4 |
| SMILES | C1=CC=CC=C1N(C(F)(F)F)C(F)(F)F |
| InChI | 1S/C8H5F6N/c9-7(10,11)15(8(12,13)14)6-4-2-1-3-5-6/h1-5H |
| InChIKey | JBGNFLUETJDDBA-UHFFFAOYSA-N |
| Density | 1.43g/cm3 (Cal.) |
|---|---|
| Boiling point | 112.258°C at 760 mmHg (Cal.) |
| Flash point | 21.694°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Bis(Trifluoromethyl) Aniline |