Online Database of Chemicals from Around the World
|
CAS#: 773-23-9 Product: alpha,alpha-Bis(Trifluoromethyl)-1-Aziridinemethanol No suppilers available for the product. |
| Name | alpha,alpha-Bis(Trifluoromethyl)-1-Aziridinemethanol |
|---|---|
| Synonyms | 2-(Aziridin-1-Yl)-1,1,1,3,3,3-Hexafluoro-Propan-2-Ol; 2-(1-Aziridinyl)-1,1,1,3,3,3-Hexafluoropropan-2-Ol; 2-Ethylenimino-1,1,1,3,3,3-Hexafluoro-Propan-2-Ol |
| Molecular Structure |  |
| Molecular Formula | C5H5F6NO |
| Molecular Weight | 209.09 |
| CAS Registry Number | 773-23-9 |
| SMILES | C1N(C(C(F)(F)F)(C(F)(F)F)O)C1 |
| InChI | 1S/C5H5F6NO/c6-4(7,8)3(13,5(9,10)11)12-1-2-12/h13H,1-2H2 |
| InChIKey | UWDWPQFDNOSJEP-UHFFFAOYSA-N |
| Density | 1.682g/cm3 (Cal.) |
|---|---|
| Boiling point | 125.88°C at 760 mmHg (Cal.) |
| Flash point | 29.931°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha,alpha-Bis(Trifluoromethyl)-1-Aziridinemethanol |