| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,5-Furandione, polymer with 2,4,4-trimethylpentene, sodium salt |
|---|---|
| Synonyms | Sodium; Tetrahydrofuran-2,5-Dione; 2,4,4-Trimethylpent-1-Ene; Sodium; Tetrahydrofuran-2,5-Quinone; 2,4,4-Trimethylpent-1-Ene |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20NaO3 |
| Molecular Weight | 235.28 |
| CAS Registry Number | 37199-81-8 |
| SMILES | C1C(OC(=O)C1)=O.C(C(C)(C)C)C(=C)C.[Na+] |
| InChI | 1S/C8H16.C4H4O3.Na/c1-7(2)6-8(3,4)5;5-3-1-2-4(6)7-3;/h1,6H2,2-5H3;1-2H2;/q;;+1 |
| InChIKey | JHBKNJSZAQSDFP-UHFFFAOYSA-N |
| Boiling point | 101.4°C at 760 mmHg (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,5-Furandione, polymer with 2,4,4-trimethylpentene, sodium salt |