Online Database of Chemicals from Around the World
|
CAS#: 92687-23-5 Product: 1,1'-[2,5-Furandiylbis(methyleneoxy)]di(2-propanol) No suppilers available for the product. |
| Name | 1,1'-[2,5-Furandiylbis(methyleneoxy)]di(2-propanol) |
|---|---|
| Molecular Structure | ![CAS#: 92687-23-5， 1,1'-[2,5-Furandiylbis(methyleneoxy)]di(2-propanol)](/moreStructures/92687-23-5.gif) |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.28 |
| CAS Registry Number | 92687-23-5 |
| EINECS | 296-418-8 |
| SMILES | CC(O)COCc1ccc(COCC(C)O)o1 |
| InChI | 1S/C12H20O5/c1-9(13)5-15-7-11-3-4-12(17-11)8-16-6-10(2)14/h3-4,9-10,13-14H,5-8H2,1-2H3 |
| InChIKey | RJNFHXTVHNEURU-UHFFFAOYSA-N |
| Density | 1.15g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.354°C at 760 mmHg (Cal.) |
| Flash point | 180.203°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-[2,5-Furandiylbis(methyleneoxy)]di(2-propanol) |