Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Diethyl (2R)-2-Chlorosuccinate |
|---|---|
| Synonyms | (R)-diethyl 2-chlorosuccinate |
| Molecular Structure |  |
| Molecular Formula | C8H13ClO4 |
| Molecular Weight | 208.64 |
| CAS Registry Number | 377751-50-3 |
| SMILES | Cl[C@@H](C(=O)OCC)CC(=O)OCC |
| InChI | 1S/C8H13ClO4/c1-3-12-7(10)5-6(9)8(11)13-4-2/h6H,3-5H2,1-2H3/t6-/m1/s1 |
| InChIKey | JWJDXJCSVYLGDD-ZCFIWIBFSA-N |
| Density | 1.164g/cm3 (Cal.) |
|---|---|
| Boiling point | 252.91°C at 760 mmHg (Cal.) |
| Flash point | 98.023°C (Cal.) |
| Refractive index | 1.442 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl (2R)-2-Chlorosuccinate |