Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BioBlocks Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (858) 558-5900 | |||
|
sales@bioblocks.com | |||
| Chemical manufacturer | ||||
| Name | Diethyl 8-chloro-2,3-quinolinedicarboxylate |
|---|---|
| Synonyms | Diethyl 8-chloro-2,3-quinolinedicarboxylate; ; Diethyl-8-chloro-2,3-quinolinedicarboxylate |
| Molecular Structure |  |
| Molecular Formula | C15H14ClNO4 |
| Molecular Weight | 307.73 |
| CAS Registry Number | 892874-60-1 |
| SMILES | CCOC(=O)c1cc2cccc(Cl)c2nc1C(=O)OCC |
| InChI | 1S/C15H14ClNO4/c1-3-20-14(18)10-8-9-6-5-7-11(16)12(9)17-13(10)15(19)21-4-2/h5-8H,3-4H2,1-2H3 |
| InChIKey | YBUQJEUWEYOPBG-UHFFFAOYSA-N |
| Density | 1.296g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.14°C at 760 mmHg (Cal.) |
| Flash point | 195.193°C (Cal.) |
| Refractive index | 1.587 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Diethyl 8-chloro-2,3-quinolinedicarboxylate |