|
CAS#: 37895-35-5 Product: Antibiotic P42-C No suppilers available for the product. |
| Name | Antibiotic P42-C |
|---|---|
| Synonyms | 2H-Xantheno(1',2',3':4:5)(1,3)Benzodioxino(7,6-G)Isoquinoline-5,14(1H,9H)-Dione, 13-Amino-3,4,8A,13-Tetrahydro-4,15,16-Trihydroxy-1-Methoxy-12-Methyl-, (1R-(1-Alpha,4-Alpha,8A-Beta))-; Albofungin; Antibiotic P 42-1 |
| Molecular Structure | ![]() |
| Molecular Formula | C27H24N2O9 |
| Molecular Weight | 520.49 |
| CAS Registry Number | 37895-35-5 |
| SMILES | C1=C6C(=C(C2=C1C=C(N(C2=O)N)C)O)C5=C(C4=C(C(C3=C(C(OC)CCC3O)O4)=O)C7=C5C(C6)OCO7)O |
| InChI | 1S/C27H24N2O9/c1-9-5-10-6-11-7-14-18-19(15(11)21(31)16(10)27(34)29(9)28)23(33)26-20(25(18)37-8-36-14)22(32)17-12(30)3-4-13(35-2)24(17)38-26/h5-6,12-14,30-31,33H,3-4,7-8,28H2,1-2H3 |
| InChIKey | LYKFTVCDYGGLGW-UHFFFAOYSA-N |
| Density | 1.714g/cm3 (Cal.) |
|---|---|
| Boiling point | 869.391°C at 760 mmHg (Cal.) |
| Flash point | 479.59°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Antibiotic P42-C |