Online Database of Chemicals from Around the World
|
CAS#: 119239-64-4 Product: Anti-Benzo(f)Quinoline-7,8-Diol-9,10-Epoxide-N-Oxide No suppilers available for the product. |
| Name | Anti-Benzo(f)Quinoline-7,8-Diol-9,10-Epoxide-N-Oxide |
|---|---|
| Synonyms | Anti-Benzo(F)Quinoline-7,8-Diol-9,10-Epoxide N-Oxide |
| Molecular Structure |  |
| Molecular Formula | C13H7NO4 |
| Molecular Weight | 241.20 |
| CAS Registry Number | 119239-64-4 |
| SMILES | O=C4C2=CC=C1N(O)C=CC=C1C2=C3OC3=C4O |
| InChI | 1S/C13H7NO4/c15-10-7-3-4-8-6(2-1-5-14(8)17)9(7)12-13(18-12)11(10)16/h1-5,16-17H |
| InChIKey | RMBZVLDFOLCMJB-UHFFFAOYSA-N |
| Density | 1.829g/cm3 (Cal.) |
|---|---|
| Boiling point | 655.541°C at 760 mmHg (Cal.) |
| Flash point | 350.259°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Anti-Benzo(f)Quinoline-7,8-Diol-9,10-Epoxide-N-Oxide |