Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Carmantadine |
|---|---|
| Synonyms | 1-(1-Adamantyl)-2-Azetidinecarboxylic Acid; Carmantadine (Usan); D03407 |
| Molecular Structure |  |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 |
| CAS Registry Number | 38081-67-3 |
| EINECS | 253-774-9 |
| SMILES | O=C(C4N(C12CC3CC(C1)CC(C2)C3)CC4)O |
| InChI | 1S/C14H21NO2/c16-13(17)12-1-2-15(12)14-6-9-3-10(7-14)5-11(4-9)8-14/h9-12H,1-8H2,(H,16,17) |
| InChIKey | VPBLOJFGPORKQA-UHFFFAOYSA-N |
| Density | 1.292g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.287°C at 760 mmHg (Cal.) |
| Flash point | 178.348°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Carmantadine |