Online Database of Chemicals from Around the World
|
CAS#: 38134-93-9 Product: 1,6-Dihydroxynaphthalene-2-Carboxylic Acid No suppilers available for the product. |
| Name | 1,6-Dihydroxynaphthalene-2-Carboxylic Acid |
|---|---|
| Synonyms | 1,6-Dihydroxy-2-Naphthalenecarboxylic Acid; 1,6-Dihydroxy-2-Naphthoic Acid; 2-Naphthalenecarboxylic Acid, 1,6-Dihydroxy- |
| Molecular Structure |  |
| Molecular Formula | C11H8O4 |
| Molecular Weight | 204.18 |
| CAS Registry Number | 38134-93-9 |
| EINECS | 253-797-4 |
| SMILES | C1=C(C=C2C(=C1)C(=C(C=C2)C(=O)O)O)O |
| InChI | 1S/C11H8O4/c12-7-2-4-8-6(5-7)1-3-9(10(8)13)11(14)15/h1-5,12-13H,(H,14,15) |
| InChIKey | GWDGEVHBWRIBPF-UHFFFAOYSA-N |
| Density | 1.536g/cm3 (Cal.) |
|---|---|
| Boiling point | 442.167°C at 760 mmHg (Cal.) |
| Flash point | 235.348°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6-Dihydroxynaphthalene-2-Carboxylic Acid |