Online Database of Chemicals from Around the World
|
CAS#: 38146-67-7 Product: (1aR-(1aR*,6aR*,7aR*,9aR*))-1a,2,6,6a,7a,8,9,9a-octahydro-1a,5,7a-trimethyl-Bisoxireno(4,5:8,9)cyclodeca(1,2-b)furan No suppilers available for the product. |
| Name | (1aR-(1aR*,6aR*,7aR*,9aR*))-1a,2,6,6a,7a,8,9,9a-octahydro-1a,5,7a-trimethyl-Bisoxireno(4,5:8,9)cyclodeca(1,2-b)furan |
|---|---|
| Synonyms | Glechomafuran; Nsc380468; Nci60_003596 |
| Molecular Structure |  |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 |
| CAS Registry Number | 38146-67-7 |
| SMILES | C4=C(C3=C(CC1(OC1CCC2(OC2C3)C)C)O4)C |
| InChI | 1S/C15H20O3/c1-9-8-16-11-7-15(3)12(17-15)4-5-14(2)13(18-14)6-10(9)11/h8,12-13H,4-7H2,1-3H3 |
| InChIKey | FNQFNSGVMLMZNV-UHFFFAOYSA-N |
| Density | 1.153g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.536°C at 760 mmHg (Cal.) |
| Flash point | 178.808°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1aR-(1aR*,6aR*,7aR*,9aR*))-1a,2,6,6a,7a,8,9,9a-octahydro-1a,5,7a-trimethyl-Bisoxireno(4,5:8,9)cyclodeca(1,2-b)furan |