Online Database of Chemicals from Around the World
|
CAS#: 67989-98-4 Product: 1-[(Octahydro-2,5,5-Trimethyl-2H-2,4alpha-Ethanonaphthalen)-8-Yl]Ethanone No suppilers available for the product. |
| Name | 1-[(Octahydro-2,5,5-Trimethyl-2H-2,4alpha-Ethanonaphthalen)-8-Yl]Ethanone |
|---|---|
| Molecular Structure | ![CAS#: 67989-98-4， 1-[(Octahydro-2,5,5-Trimethyl-2H-2,4alpha-Ethanonaphthalen)-8-Yl]Ethanone](/moreStructures/67989-98-4.gif) |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 |
| CAS Registry Number | 67989-98-4 |
| SMILES | CC3(C12CCC(CC1)(CC2C(CC3)C(=O)C)C)C |
| InChI | 1S/C17H28O/c1-12(18)13-5-6-15(2,3)17-9-7-16(4,8-10-17)11-14(13)17/h13-14H,5-11H2,1-4H3 |
| InChIKey | RVDZMZCRDXUENU-UHFFFAOYSA-N |
| Density | 0.986g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.757°C at 760 mmHg (Cal.) |
| Flash point | 159.637°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(Octahydro-2,5,5-Trimethyl-2H-2,4alpha-Ethanonaphthalen)-8-Yl]Ethanone |