Online Database of Chemicals from Around the World
| Name | 1-Dimethoxyphosphorylsulfanyl-4-Nitrobenzene |
|---|---|
| Synonyms | 1-Dimethoxyphosphorylsulfanyl-4-Nitro-Benzene; 1-(Dimethoxyphosphorylthio)-4-Nitrobenzene; 1-(Dimethoxyphosphorylthio)-4-Nitro-Benzene |
| Molecular Structure |  |
| Molecular Formula | C8H10NO5PS |
| Molecular Weight | 263.20 |
| CAS Registry Number | 3820-53-9 |
| SMILES | C1=C([N+]([O-])=O)C=CC(=C1)S[P](=O)(OC)OC |
| InChI | 1S/C8H10NO5PS/c1-13-15(12,14-2)16-8-5-3-7(4-6-8)9(10)11/h3-6H,1-2H3 |
| InChIKey | DHPZHUPSZPYWMB-UHFFFAOYSA-N |
| Density | 1.405g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.144°C at 760 mmHg (Cal.) |
| Flash point | 178.262°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Dimethoxyphosphorylsulfanyl-4-Nitrobenzene |
