Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 (431) 5606-600 | |||
|
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Name | 3,4-Dimethoxyphthalic Acid |
|---|---|
| Synonyms | Oprea1_748262; 1,2-Benzenedicarboxylic Acid, 3,4-Dimethoxy-; Hemipinic Acid |
| Molecular Structure |  |
| Molecular Formula | C10H10O6 |
| Molecular Weight | 226.19 |
| CAS Registry Number | 518-90-1 |
| EINECS | 208-259-3 |
| SMILES | C1=CC(=C(C(=C1C(O)=O)C(O)=O)OC)OC |
| InChI | 1S/C10H10O6/c1-15-6-4-3-5(9(11)12)7(10(13)14)8(6)16-2/h3-4H,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | QSWJYWSRUJSAFH-UHFFFAOYSA-N |
| Density | 1.392g/cm3 (Cal.) |
|---|---|
| Boiling point | 396.152°C at 760 mmHg (Cal.) |
| Flash point | 157.765°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dimethoxyphthalic Acid |