Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6,7-Dimethyl-1H-Naphtho[2,3-d]Imidazole |
|---|---|
| Synonyms | 6,7-dimethyl-1H-naphtho[2,3-d]imidazole |
| Molecular Structure | ![CAS#: 38837-60-4， 6,7-Dimethyl-1H-Naphtho[2,3-d]Imidazole](/moreStructures/38837-60-4.gif) |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 |
| CAS Registry Number | 38837-60-4 |
| SMILES | Cc1cc2cc3c(cc2cc1C)nc[nH]3 |
| InChI | 1S/C13H12N2/c1-8-3-10-5-12-13(15-7-14-12)6-11(10)4-9(8)2/h3-7H,1-2H3,(H,14,15) |
| InChIKey | UXXNLFRDHZPWLA-UHFFFAOYSA-N |
| Density | 1.213g/cm3 (Cal.) |
|---|---|
| Boiling point | 476.383°C at 760 mmHg (Cal.) |
| Flash point | 274.68°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Dimethyl-1H-Naphtho[2,3-d]Imidazole |