Online Database of Chemicals from Around the World
|
CAS#: 39091-73-1 Product: 1,2,3,4-Tetrakis(Trifluoromethyl)-5-Thiabicyclo[2.1.0]Pent-2-Ene No suppilers available for the product. |
| Name | 1,2,3,4-Tetrakis(Trifluoromethyl)-5-Thiabicyclo[2.1.0]Pent-2-Ene |
|---|---|
| Synonyms | 1,2,3,4-T |
| Molecular Structure | ![CAS#: 39091-73-1， 1,2,3,4-Tetrakis(Trifluoromethyl)-5-Thiabicyclo[2.1.0]Pent-2-Ene](/moreStructures/39091-73-1.gif) |
| Molecular Formula | C8F12S |
| Molecular Weight | 356.13 |
| CAS Registry Number | 39091-73-1 |
| SMILES | FC(F)(F)C\12SC2(/C(=C/1C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | 1S/C8F12S/c9-5(10,11)1-2(6(12,13)14)4(8(18,19)20)3(1,21-4)7(15,16)17 |
| InChIKey | KJBUGUZZNRVQCZ-UHFFFAOYSA-N |
| Density | 1.975g/cm3 (Cal.) |
|---|---|
| Boiling point | 92.558°C at 760 mmHg (Cal.) |
| Flash point | 9.779°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4-Tetrakis(Trifluoromethyl)-5-Thiabicyclo[2.1.0]Pent-2-Ene |