Online Database of Chemicals from Around the World
|
CAS#: 393-02-2 Product: tetrakis(trifluoromethyl)-Cyclobutaphosphane No suppilers available for the product. |
| Name | tetrakis(trifluoromethyl)-Cyclobutaphosphane |
|---|---|
| Synonyms | 1,2,3,4-Tetrakis(Trifluoromethyl)-1,2,3,4-Tetraphosphetane; Cyclobutaphosphane, Tetrakis(Trifluoromethyl)-; Tetraphosphetane,Tetrakis(Trifluoromethyl)- |
| Molecular Structure |  |
| Molecular Formula | C4F12P4 |
| Molecular Weight | 399.92 |
| CAS Registry Number | 393-02-2 |
| SMILES | FC(P1P(P(P1C(F)(F)F)C(F)(F)F)C(F)(F)F)(F)F |
| InChI | 1S/C4F12P4/c5-1(6,7)17-18(2(8,9)10)20(4(14,15)16)19(17)3(11,12)13 |
| InChIKey | TVWVWIPMQJSXJS-UHFFFAOYSA-N |
| Boiling point | 85.493°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 5.506°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for tetrakis(trifluoromethyl)-Cyclobutaphosphane |