Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,3,4,5-Tetrabromo-6-Chlorotoluene |
|---|---|
| Synonyms | 1,2,3,4-Tetrabromo-5-Chloro-6-Methyl-Benzene; Tetrabromo-2-Chlorotoluene; Benzene, 1,2,3,4-Tetrabromo-5-Chloro-6-Methyl- |
| Molecular Structure |  |
| Molecular Formula | C7H3Br4Cl |
| Molecular Weight | 442.17 |
| CAS Registry Number | 39569-21-6 |
| EINECS | 254-522-0 |
| SMILES | CC1=C(Cl)C(=C(Br)C(=C1Br)Br)Br |
| InChI | 1S/C7H3Br4Cl/c1-2-3(8)4(9)5(10)6(11)7(2)12/h1H3 |
| InChIKey | WMXWTOJJASZOCL-UHFFFAOYSA-N |
| Density | 2.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.272°C at 760 mmHg (Cal.) |
| Flash point | 198.119°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,3,4,5-Tetrabromo-6-Chlorotoluene |