Online Database of Chemicals from Around the World
|
CAS#: 67733-57-7 Product: 2,3,7,8-Tetrabromodibenzofuran No suppilers available for the product. |
| Name | 2,3,7,8-Tetrabromodibenzofuran |
|---|---|
| Synonyms | Dibenzofuran, 2,3,7,8-Tetrabromo-; 4-17-00-00590 (Beilstein Handbook Reference); Brn 0221403 |
| Molecular Structure |  |
| Molecular Formula | C12H4Br4O |
| Molecular Weight | 483.78 |
| CAS Registry Number | 67733-57-7 |
| SMILES | C1=C(C(=CC2=C1OC3=C2C=C(C(=C3)Br)Br)Br)Br |
| InChI | 1S/C12H4Br4O/c13-7-1-5-6-2-8(14)10(16)4-12(6)17-11(5)3-9(7)15/h1-4H |
| InChIKey | HCSRVQXNLHZQNM-UHFFFAOYSA-N |
| Density | 2.358g/cm3 (Cal.) |
|---|---|
| Boiling point | 495.926°C at 760 mmHg (Cal.) |
| Flash point | 253.727°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,7,8-Tetrabromodibenzofuran |