Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (2R,3S)-2-Cyclohexyl-3-Ethynyloxirane |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 |
| CAS Registry Number | 399512-82-4 |
| SMILES | C#C[C@H]1[C@H](O1)C2CCCCC2 |
| InChI | 1S/C10H14O/c1-2-9-10(11-9)8-6-4-3-5-7-8/h1,8-10H,3-7H2/t9-,10+/m0/s1 |
| InChIKey | XRCBSTKQYYHSNI-VHSXEESVSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 204.5±29.0°C at 760 mmHg (Cal.) |
| Flash point | 69.7±20.0°C (Cal.) |
| Refractive index | 1.497 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,3S)-2-Cyclohexyl-3-Ethynyloxirane |