| Creative Peptides | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 624-4882 | |||
![]() |
info@creative-peptides.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 3-Cyclohexyl-N-[(9H-Fluoren-9-Ylmethoxy)Carbonyl]-L-Alanyl-N-(4-Methyl-2-Oxo-2H-Chromen-7-Yl)-L-Lysinamide |
|---|---|
| Synonyms | 3-Cyclohe |
| Molecular Structure | ![]() |
| Molecular Formula | C40H46N4O6 |
| Molecular Weight | 678.82 |
| CAS Registry Number | 475115-35-6 |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC3CCCCC3)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
| InChI | 1S/C40H46N4O6/c1-25-21-37(45)50-36-23-27(18-19-28(25)36)42-38(46)34(17-9-10-20-41)43-39(47)35(22-26-11-3-2-4-12-26)44-40(48)49-24-33-31-15-7-5-13-29(31)30-14-6-8-16-32(30)33/h5-8,13-16,18-19,21,23,26,33-35H,2-4,9-12,17,20,22,24,41H2,1H3,(H,42,46)(H,43,47)(H,44,48)/t34-,35-/m0/s1 |
| InChIKey | IKNOZZKXIDSTRN-PXLJZGITSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 937.5±65.0°C at 760 mmHg (Cal.) |
| Flash point | 520.8±34.3°C (Cal.) |
| Refractive index | 1.614 (Cal.) |
| solubility | Soluble to 67.88 mg/ml in DMSO and to 16.97 mg/ml in ethanol |
| Market Analysis Reports |
| List of Reports Available for 3-Cyclohexyl-N-[(9H-Fluoren-9-Ylmethoxy)Carbonyl]-L-Alanyl-N-(4-Methyl-2-Oxo-2H-Chromen-7-Yl)-L-Lysinamide |