Online Database of Chemicals from Around the World
|
CAS#: 40356-57-8 Product: Octachloro diphenyl ether No suppilers available for the product. |
| Name | Octachloro diphenyl ether |
|---|---|
| Synonyms | Benzene, 1,1'-Oxybis-, Octachloro Deriv.; Ether, Octachlorodiphenyl; Octachloro Diphenyl Ether |
| Molecular Structure |  |
| Molecular Formula | C12H2Cl8O |
| Molecular Weight | 445.77 |
| CAS Registry Number | 40356-57-8 |
| SMILES | C1=C(C(=C(C(=C1Cl)OC2=C(C(=C(C(=C2)Cl)Cl)Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C12H2Cl8O/c13-3-1-5(15)12(11(20)8(3)17)21-6-2-4(14)7(16)10(19)9(6)18/h1-2H |
| InChIKey | HYNYIQBCBHJTOZ-UHFFFAOYSA-N |
| Density | 1.744g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.937°C at 760 mmHg (Cal.) |
| Flash point | 145.715°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Octachloro diphenyl ether |