Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,1,1,3,6,8,8,8-Octachlorooctane |
|---|---|
| Synonyms | 1,1,1,3,6,8,8,8-OCTACHLOROOCTANE |
| Molecular Structure |  |
| Molecular Formula | C8H10Cl8 |
| Molecular Weight | 389.79 |
| CAS Registry Number | 61856-19-7 |
| SMILES | ClC(CCC(Cl)CC(Cl)(Cl)Cl)CC(Cl)(Cl)Cl |
| InChI | 1S/C8H10Cl8/c9-5(3-7(11,12)13)1-2-6(10)4-8(14,15)16/h5-6H,1-4H2 |
| InChIKey | NRBGXCOKLPAQMS-UHFFFAOYSA-N |
| Density | 1.544g/cm3 (Cal.) |
|---|---|
| Boiling point | 565.894°C at 760 mmHg (Cal.) |
| Flash point | 314.764°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1,3,6,8,8,8-Octachlorooctane |