Online Database of Chemicals from Around the World
|
CAS#: 40572-19-8 Product: 1,3,5-Tris(2,2-Dimethylpropyl)-2-Nitrobenzene No suppilers available for the product. |
| Name | 1,3,5-Tris(2,2-Dimethylpropyl)-2-Nitrobenzene |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.51 |
| CAS Registry Number | 40572-19-8 |
| SMILES | [O-][N+](=O)c1c(cc(cc1CC(C)(C)C)CC(C)(C)C)CC(C)(C)C |
| InChI | 1S/C21H35NO2/c1-19(2,3)12-15-10-16(13-20(4,5)6)18(22(23)24)17(11-15)14-21(7,8)9/h10-11H,12-14H2,1-9H3 |
| InChIKey | ACWSHQYPMFHBQV-UHFFFAOYSA-N |
| Density | 0.957g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.788°C at 760 mmHg (Cal.) |
| Flash point | 147.99°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Tris(2,2-Dimethylpropyl)-2-Nitrobenzene |